C25H34N2O4 — CID 71716712
2,7-bis(6-aminohexoxy)xanthen-9-one (PubChem CID 71716712) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2,7-bis(6-aminohexoxy)xanthen-9-one.
| Compound Name | 2,7-bis(6-aminohexoxy)xanthen-9-one |
|---|---|
| PubChem CID | 71716712 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2,7-bis(6-aminohexoxy)xanthen-9-one |
| SMILES | NCCCCCCOc1ccc2oc3ccc(OCCCCCCN)cc3c(=O)c2c1 |
| InChI | InChI=1S/C25H34N2O4/c26-13-5-1-3-7-15-29-19-9-11-23-21(17-19)25(28)22-18-20(10-12-24(22)31-23)30-16-8-4-2-6-14-27/h9-12,17-18H,1-8,13-16,26-27H2 |
| InChIKey | PCXSGILLBJCPIV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|