C20H22N4O6S — CID 25206584
[3-[[3-amino-6-(methylsulfamoyl)-2-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 25206584) has the molecular formula C20H22N4O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is [3-[[3-amino-6-(methylsulfamoyl)-2-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-[[3-amino-6-(methylsulfamoyl)-2-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 25206584 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [3-[[3-amino-6-(methylsulfamoyl)-2-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | CNS(=O)(=O)c1ccc(N)c(Cc2c(C)c3ccc(OC(=O)N(C)C)cc3oc2=O)n1 |
| InChI | InChI=1S/C20H22N4O6S/c1-11-13-6-5-12(29-20(26)24(3)4)9-17(13)30-19(25)14(11)10-16-15(21)7-8-18(23-16)31(27,28)22-2/h5-9,22H,10,21H2,1-4H3 |
| InChIKey | UHJXWDTZQDAHMD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|