C20H22N4O8S2 — CID 59139284
[4-methyl-3-[[2-(methylsulfamoylamino)phenyl]sulfonylamino]-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 59139284) has the molecular formula C20H22N4O8S2 and a molecular weight of 510.55 g/mol. Its IUPAC name is [4-methyl-3-[[2-(methylsulfamoylamino)phenyl]sulfonylamino]-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [4-methyl-3-[[2-(methylsulfamoylamino)phenyl]sulfonylamino]-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 59139284 |
| Molecular Formula | C20H22N4O8S2 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | [4-methyl-3-[[2-(methylsulfamoylamino)phenyl]sulfonylamino]-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | CNS(=O)(=O)Nc1ccccc1S(=O)(=O)Nc1c(C)c2ccc(OC(=O)N(C)C)cc2oc1=O |
| InChI | InChI=1S/C20H22N4O8S2/c1-12-14-10-9-13(31-20(26)24(3)4)11-16(14)32-19(25)18(12)23-33(27,28)17-8-6-5-7-15(17)22-34(29,30)21-2/h5-11,21-23H,1-4H3 |
| InChIKey | KFKUEVXSSFFOMZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|