C24H19ClO3 — CID 2000257
3-(4-chlorophenyl)-7-[(2,5-dimethylphenyl)methoxy]chromen-4-one (PubChem CID 2000257) has the molecular formula C24H19ClO3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-7-[(2,5-dimethylphenyl)methoxy]chromen-4-one.
| Compound Name | 3-(4-chlorophenyl)-7-[(2,5-dimethylphenyl)methoxy]chromen-4-one |
|---|---|
| PubChem CID | 2000257 |
| Molecular Formula | C24H19ClO3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 3-(4-chlorophenyl)-7-[(2,5-dimethylphenyl)methoxy]chromen-4-one |
| SMILES | Cc1ccc(C)c(COc2ccc3c(=O)c(-c4ccc(Cl)cc4)coc3c2)c1 |
| InChI | InChI=1S/C24H19ClO3/c1-15-3-4-16(2)18(11-15)13-27-20-9-10-21-23(12-20)28-14-22(24(21)26)17-5-7-19(25)8-6-17/h3-12,14H,13H2,1-2H3 |
| InChIKey | PAWAWDDBWROVNN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |