C23H25NO5 — CID 163082505
N-(1-hydroxy-4-methylpentan-2-yl)-2-(4-oxo-3-phenylchromen-7-yl)oxyacetamide (PubChem CID 163082505) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylpentan-2-yl)-2-(4-oxo-3-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-(1-hydroxy-4-methylpentan-2-yl)-2-(4-oxo-3-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 163082505 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-(1-hydroxy-4-methylpentan-2-yl)-2-(4-oxo-3-phenylchromen-7-yl)oxyacetamide |
| SMILES | CC(C)CC(CO)NC(=O)COc1ccc2c(=O)c(-c3ccccc3)coc2c1 |
| InChI | InChI=1S/C23H25NO5/c1-15(2)10-17(12-25)24-22(26)14-28-18-8-9-19-21(11-18)29-13-20(23(19)27)16-6-4-3-5-7-16/h3-9,11,13,15,17,25H,10,12,14H2,1-2H3,(H,24,26) |
| InChIKey | DDRORYPSWWLBSJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |