C26H27NO6 — CID 146319440
ethyl (3S)-1-[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]piperidine-3-carboxylate (PubChem CID 146319440) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is ethyl (3S)-1-[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 146319440 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | ethyl (3S)-1-[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)[C@@H](C)Oc2ccc3c(-c4ccccc4)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C26H27NO6/c1-3-31-26(30)19-10-7-13-27(16-19)25(29)17(2)32-20-11-12-21-22(18-8-5-4-6-9-18)15-24(28)33-23(21)14-20/h4-6,8-9,11-12,14-15,17,19H,3,7,10,13,16H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | YSXFPXCBPXLESQ-MJGOQNOKSA-N |
| XLogP | 4.03 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|