C26H29NO6S — CID 138490853
ethyl 2-[(3R)-1-[2-[4-(3-methylthiophen-2-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate (PubChem CID 138490853) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is ethyl 2-[(3R)-1-[2-[4-(3-methylthiophen-2-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3R)-1-[2-[4-(3-methylthiophen-2-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 138490853 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl 2-[(3R)-1-[2-[4-(3-methylthiophen-2-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCCN(C(=O)C(C)Oc2ccc3c(-c4sccc4C)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C26H29NO6S/c1-4-31-23(28)12-18-6-5-10-27(15-18)26(30)17(3)32-19-7-8-20-21(25-16(2)9-11-34-25)14-24(29)33-22(20)13-19/h7-9,11,13-14,17-18H,4-6,10,12,15H2,1-3H3/t17?,18-/m1/s1 |
| InChIKey | HSJNDSXIAYPCBB-QRWMCTBCSA-N |
| XLogP | 4.79 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|