C23H23NO6S — CID 138490592
(3S)-1-[2-[4-(4-methylthiophen-3-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid (PubChem CID 138490592) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is (3S)-1-[2-[4-(4-methylthiophen-3-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[2-[4-(4-methylthiophen-3-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 138490592 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (3S)-1-[2-[4-(4-methylthiophen-3-yl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid |
| SMILES | Cc1cscc1-c1cc(=O)oc2cc(OC(C)C(=O)N3CCC[C@H](C(=O)O)C3)ccc12 |
| InChI | InChI=1S/C23H23NO6S/c1-13-11-31-12-19(13)18-9-21(25)30-20-8-16(5-6-17(18)20)29-14(2)22(26)24-7-3-4-15(10-24)23(27)28/h5-6,8-9,11-12,14-15H,3-4,7,10H2,1-2H3,(H,27,28)/t14?,15-/m0/s1 |
| InChIKey | DKHOGMNPDYOBEX-LOACHALJSA-N |
| XLogP | 3.92 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|