C25H25NO6 — CID 138490753
(3R)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid (PubChem CID 138490753) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is (3R)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 138490753 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (3R)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc(OC(C)C(=O)N3CCC[C@@H](C(=O)O)C3)ccc12 |
| InChI | InChI=1S/C25H25NO6/c1-15-6-3-4-8-19(15)21-13-23(27)32-22-12-18(9-10-20(21)22)31-16(2)24(28)26-11-5-7-17(14-26)25(29)30/h3-4,6,8-10,12-13,16-17H,5,7,11,14H2,1-2H3,(H,29,30)/t16?,17-/m1/s1 |
| InChIKey | PEVNVQFIAFRVJX-ZYMOGRSISA-N |
| XLogP | 3.86 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|