C30H26ClNO6 — CID 155119669
(3S)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylic acid (PubChem CID 155119669) has the molecular formula C30H26ClNO6 and a molecular weight of 531.99 g/mol. Its IUPAC name is (3S)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155119669 |
| Molecular Formula | C30H26ClNO6 |
| Molecular Weight | 531.99 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | (3S)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylic acid |
| SMILES | C[C@@H](Oc1ccc2c(-c3ccccc3Cl)cc(=O)oc2c1)C(=O)N1CC(c2ccccc2)C[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C30H26ClNO6/c1-18(29(34)32-16-20(13-21(17-32)30(35)36)19-7-3-2-4-8-19)37-22-11-12-24-25(15-28(33)38-27(24)14-22)23-9-5-6-10-26(23)31/h2-12,14-15,18,20-21H,13,16-17H2,1H3,(H,35,36)/t18-,20?,21+/m1/s1 |
| InChIKey | DJIPPERODAFLLJ-IZWFHCBGSA-N |
| XLogP | 5.60 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|