C25H24ClNO6 — CID 138490837
2-[1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetic acid (PubChem CID 138490837) has the molecular formula C25H24ClNO6 and a molecular weight of 469.92 g/mol. Its IUPAC name is 2-[1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 138490837 |
| Molecular Formula | C25H24ClNO6 |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetic acid |
| SMILES | CC(Oc1ccc2c(-c3ccccc3Cl)cc(=O)oc2c1)C(=O)N1CCCC(CC(=O)O)C1 |
| InChI | InChI=1S/C25H24ClNO6/c1-15(25(31)27-10-4-5-16(14-27)11-23(28)29)32-17-8-9-19-20(13-24(30)33-22(19)12-17)18-6-2-3-7-21(18)26/h2-3,6-9,12-13,15-16H,4-5,10-11,14H2,1H3,(H,28,29) |
| InChIKey | YPFYEYFAHXBPKG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|