C26H24ClNO6 — CID 175046611
methyl 2-[(3R)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate (PubChem CID 175046611) has the molecular formula C26H24ClNO6 and a molecular weight of 481.93 g/mol. Its IUPAC name is methyl 2-[(3R)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate.
| Compound Name | methyl 2-[(3R)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 175046611 |
| Molecular Formula | C26H24ClNO6 |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | methyl 2-[(3R)-1-[(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCCN(C(=O)[C@@H](C=O)c2ccc3c(-c4ccccc4Cl)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C26H24ClNO6/c1-33-24(30)11-16-5-4-10-28(14-16)26(32)21(15-29)17-8-9-19-20(13-25(31)34-23(19)12-17)18-6-2-3-7-22(18)27/h2-3,6-9,12-13,15-16,21H,4-5,10-11,14H2,1H3/t16-,21+/m1/s1 |
| InChIKey | ZAHSVFJIQFYTFN-IERDGZPVSA-N |
| XLogP | 4.20 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|