C25H23ClN2O5 — CID 175046208
1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]-N-methylpiperidine-3-carboxamide (PubChem CID 175046208) has the molecular formula C25H23ClN2O5 and a molecular weight of 466.92 g/mol. Its IUPAC name is 1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 175046208 |
| Molecular Formula | C25H23ClN2O5 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(C(=O)C(C=O)c2ccc3c(-c4ccccc4Cl)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C25H23ClN2O5/c1-27-24(31)16-5-4-10-28(13-16)25(32)20(14-29)15-8-9-18-19(12-23(30)33-22(18)11-15)17-6-2-3-7-21(17)26/h2-3,6-9,11-12,14,16,20H,4-5,10,13H2,1H3,(H,27,31) |
| InChIKey | FXCQHZKZQZFMDE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|