C32H35ClFNO6 — CID 175043345
heptyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate (PubChem CID 175043345) has the molecular formula C32H35ClFNO6 and a molecular weight of 584.08 g/mol. Its IUPAC name is heptyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate.
| Compound Name | heptyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 175043345 |
| Molecular Formula | C32H35ClFNO6 |
| Molecular Weight | 584.08 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | heptyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate |
| SMILES | CCCCCCCOC(=O)C[C@H]1CCCN(C(=O)[C@@H](C=O)c2ccc3c(-c4ccc(F)cc4Cl)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C32H35ClFNO6/c1-2-3-4-5-6-14-40-30(37)15-21-8-7-13-35(19-21)32(39)27(20-36)22-9-11-25-26(18-31(38)41-29(25)16-22)24-12-10-23(34)17-28(24)33/h9-12,16-18,20-21,27H,2-8,13-15,19H2,1H3/t21-,27+/m1/s1 |
| InChIKey | YFOOVFFHIMJHFV-ZBLYBZFDSA-N |
| XLogP | 6.68 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.08 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|