C26H24ClFN2O5 — CID 138490855
N-[(3S)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]prop-2-enamide (PubChem CID 138490855) has the molecular formula C26H24ClFN2O5 and a molecular weight of 498.94 g/mol. Its IUPAC name is N-[(3S)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 138490855 |
| Molecular Formula | C26H24ClFN2O5 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-[(3S)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(C(=O)[C@@H](C)Oc2ccc3c(-c4ccc(F)cc4Cl)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C26H24ClFN2O5/c1-3-24(31)29-17-5-4-10-30(14-17)26(33)15(2)34-18-7-9-20-21(13-25(32)35-23(20)12-18)19-8-6-16(28)11-22(19)27/h3,6-9,11-13,15,17H,1,4-5,10,14H2,2H3,(H,29,31)/t15-,17+/m1/s1 |
| InChIKey | KQFDJCIAPDXDBN-WBVHZDCISA-N |
| XLogP | 4.31 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|