C28H29ClFNO6 — CID 138490815
propan-2-yl 2-[(3R)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate (PubChem CID 138490815) has the molecular formula C28H29ClFNO6 and a molecular weight of 529.99 g/mol. Its IUPAC name is propan-2-yl 2-[(3R)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(3R)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 138490815 |
| Molecular Formula | C28H29ClFNO6 |
| Molecular Weight | 529.99 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | propan-2-yl 2-[(3R)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)C[C@H]1CCCN(C(=O)C(C)Oc2ccc3c(-c4ccc(F)cc4Cl)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C28H29ClFNO6/c1-16(2)35-26(32)11-18-5-4-10-31(15-18)28(34)17(3)36-20-7-9-22-23(14-27(33)37-25(22)13-20)21-8-6-19(30)12-24(21)29/h6-9,12-14,16-18H,4-5,10-11,15H2,1-3H3/t17?,18-/m1/s1 |
| InChIKey | LOVHAOFSPZJCML-QRWMCTBCSA-N |
| XLogP | 5.60 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|