C28H31NO6 — CID 151223866
ethyl 2-[1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate (PubChem CID 151223866) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is ethyl 2-[1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 151223866 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | ethyl 2-[1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetate |
| SMILES | CCOC(=O)CC1CCCN(C(=O)C(C)Oc2ccc3c(-c4ccccc4C)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C28H31NO6/c1-4-33-26(30)14-20-9-7-13-29(17-20)28(32)19(3)34-21-11-12-23-24(16-27(31)35-25(23)15-21)22-10-6-5-8-18(22)2/h5-6,8,10-12,15-16,19-20H,4,7,9,13-14,17H2,1-3H3 |
| InChIKey | NMVYMOPGESVEMV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|