C33H33NO6 — CID 155119661
ethyl (3S)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylate (PubChem CID 155119661) has the molecular formula C33H33NO6 and a molecular weight of 539.63 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 155119661 |
| Molecular Formula | C33H33NO6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | ethyl (3S)-1-[2-[4-(2-methylphenyl)-2-oxochromen-7-yl]oxypropanoyl]-5-phenylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(c2ccccc2)CN(C(=O)C(C)Oc2ccc3c(-c4ccccc4C)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C33H33NO6/c1-4-38-33(37)25-16-24(23-11-6-5-7-12-23)19-34(20-25)32(36)22(3)39-26-14-15-28-29(18-31(35)40-30(28)17-26)27-13-9-8-10-21(27)2/h5-15,17-18,22,24-25H,4,16,19-20H2,1-3H3/t22?,24?,25-/m0/s1 |
| InChIKey | UHLNRHPJSOVPFS-DWJCEPTDSA-N |
| XLogP | 5.73 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|