C26H26ClNO6 — CID 138498529
ethyl (3S)-1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylate (PubChem CID 138498529) has the molecular formula C26H26ClNO6 and a molecular weight of 483.95 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 138498529 |
| Molecular Formula | C26H26ClNO6 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | ethyl (3S)-1-[2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)C(C)Oc2ccc3c(-c4ccccc4Cl)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C26H26ClNO6/c1-3-32-26(31)17-7-6-12-28(15-17)25(30)16(2)33-18-10-11-20-21(14-24(29)34-23(20)13-18)19-8-4-5-9-22(19)27/h4-5,8-11,13-14,16-17H,3,6-7,12,15H2,1-2H3/t16?,17-/m0/s1 |
| InChIKey | LKRIRJPEXKHYOM-DJNXLDHESA-N |
| XLogP | 4.68 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|