C24H22ClFN2O5 — CID 154634606
1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxamide (PubChem CID 154634606) has the molecular formula C24H22ClFN2O5 and a molecular weight of 472.90 g/mol. Its IUPAC name is 1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 154634606 |
| Molecular Formula | C24H22ClFN2O5 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidine-3-carboxamide |
| SMILES | C[C@@H](Oc1ccc2c(-c3ccc(F)cc3Cl)cc(=O)oc2c1)C(=O)N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C24H22ClFN2O5/c1-13(24(31)28-8-2-3-14(12-28)23(27)30)32-16-5-7-18-19(11-22(29)33-21(18)10-16)17-6-4-15(26)9-20(17)25/h4-7,9-11,13-14H,2-3,8,12H2,1H3,(H2,27,30)/t13-,14?/m1/s1 |
| InChIKey | URVUJNLENMJXPT-KWCCSABGSA-N |
| XLogP | 3.74 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|