C23H21ClFNO4 — CID 142547510
4-(2-chloro-3-fluorophenyl)-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)oxychromen-2-one (PubChem CID 142547510) has the molecular formula C23H21ClFNO4 and a molecular weight of 429.88 g/mol. Its IUPAC name is 4-(2-chloro-3-fluorophenyl)-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)oxychromen-2-one.
| Compound Name | 4-(2-chloro-3-fluorophenyl)-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)oxychromen-2-one |
|---|---|
| PubChem CID | 142547510 |
| Molecular Formula | C23H21ClFNO4 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 4-(2-chloro-3-fluorophenyl)-7-(1-oxo-1-piperidin-1-ylpropan-2-yl)oxychromen-2-one |
| SMILES | CC(Oc1ccc2c(-c3cccc(F)c3Cl)cc(=O)oc2c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H21ClFNO4/c1-14(23(28)26-10-3-2-4-11-26)29-15-8-9-16-18(13-21(27)30-20(16)12-15)17-6-5-7-19(25)22(17)24/h5-9,12-14H,2-4,10-11H2,1H3 |
| InChIKey | ZCJRWSXGNUDQPZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|