C25H23Cl2FN2O5 — CID 138490789
2-chloro-N-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetamide (PubChem CID 138490789) has the molecular formula C25H23Cl2FN2O5 and a molecular weight of 521.37 g/mol. Its IUPAC name is 2-chloro-N-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetamide.
| Compound Name | 2-chloro-N-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 138490789 |
| Molecular Formula | C25H23Cl2FN2O5 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 2-chloro-N-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]oxypropanoyl]piperidin-3-yl]acetamide |
| SMILES | CC(Oc1ccc2c(-c3ccc(F)cc3Cl)cc(=O)oc2c1)C(=O)N1CCC[C@H](NC(=O)CCl)C1 |
| InChI | InChI=1S/C25H23Cl2FN2O5/c1-14(25(33)30-8-2-3-16(13-30)29-23(31)12-26)34-17-5-7-19-20(11-24(32)35-22(19)10-17)18-6-4-15(28)9-21(18)27/h4-7,9-11,14,16H,2-3,8,12-13H2,1H3,(H,29,31)/t14?,16-/m0/s1 |
| InChIKey | SHPOCAAVYDIFFX-WMCAAGNKSA-N |
| XLogP | 4.37 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|