C26H26Cl2FN3O3 — CID 155127257
2-[(3R)-1-[2-[2-chloro-4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxypropanoyl]piperidin-3-yl]-N-methylacetamide (PubChem CID 155127257) has the molecular formula C26H26Cl2FN3O3 and a molecular weight of 518.42 g/mol. Its IUPAC name is 2-[(3R)-1-[2-[2-chloro-4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxypropanoyl]piperidin-3-yl]-N-methylacetamide.
| Compound Name | 2-[(3R)-1-[2-[2-chloro-4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxypropanoyl]piperidin-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 155127257 |
| Molecular Formula | C26H26Cl2FN3O3 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 2-[(3R)-1-[2-[2-chloro-4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxypropanoyl]piperidin-3-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@H]1CCCN(C(=O)C(C)Oc2ccc3c(-c4ccc(F)cc4Cl)cc(Cl)nc3c2)C1 |
| InChI | InChI=1S/C26H26Cl2FN3O3/c1-15(26(34)32-9-3-4-16(14-32)10-25(33)30-2)35-18-6-8-20-21(13-24(28)31-23(20)12-18)19-7-5-17(29)11-22(19)27/h5-8,11-13,15-16H,3-4,9-10,14H2,1-2H3,(H,30,33)/t15?,16-/m1/s1 |
| InChIKey | QUENHQVGWCONQY-OEMAIJDKSA-N |
| XLogP | 5.49 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|