C30H29ClFNO9 — CID 175044957
propan-2-yloxycarbonyloxymethyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate (PubChem CID 175044957) has the molecular formula C30H29ClFNO9 and a molecular weight of 602.01 g/mol. Its IUPAC name is propan-2-yloxycarbonyloxymethyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate.
| Compound Name | propan-2-yloxycarbonyloxymethyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 175044957 |
| Molecular Formula | C30H29ClFNO9 |
| Molecular Weight | 602.01 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | propan-2-yloxycarbonyloxymethyl 2-[(3R)-1-[(2R)-2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)OCOC(=O)C[C@H]1CCCN(C(=O)[C@@H](C=O)c2ccc3c(-c4ccc(F)cc4Cl)cc(=O)oc3c2)C1 |
| InChI | InChI=1S/C30H29ClFNO9/c1-17(2)41-30(38)40-16-39-27(35)10-18-4-3-9-33(14-18)29(37)24(15-34)19-5-7-22-23(13-28(36)42-26(22)11-19)21-8-6-20(32)12-25(21)31/h5-8,11-13,15,17-18,24H,3-4,9-10,14,16H2,1-2H3/t18-,24+/m1/s1 |
| InChIKey | IUJXJNWEFQXKQU-KOSHJBKYSA-N |
| XLogP | 5.23 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|