C24H19ClFNO6 — CID 175040792
2-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]pyrrolidin-3-yl]acetic acid (PubChem CID 175040792) has the molecular formula C24H19ClFNO6 and a molecular weight of 471.87 g/mol. Its IUPAC name is 2-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]pyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]pyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 175040792 |
| Molecular Formula | C24H19ClFNO6 |
| Molecular Weight | 471.87 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 2-[(3S)-1-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]pyrrolidin-3-yl]acetic acid |
| SMILES | O=CC(C(=O)N1CC[C@@H](CC(=O)O)C1)c1ccc2c(-c3ccc(F)cc3Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H19ClFNO6/c25-20-9-15(26)2-4-16(20)18-10-23(31)33-21-8-14(1-3-17(18)21)19(12-28)24(32)27-6-5-13(11-27)7-22(29)30/h1-4,8-10,12-13,19H,5-7,11H2,(H,29,30)/t13-,19?/m0/s1 |
| InChIKey | YIRVMKIWGQNXMC-YTJLLHSVSA-N |
| XLogP | 3.86 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|