C24H14ClFN2O6 — CID 175044948
5-[[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]amino]pyridine-2-carboxylic acid (PubChem CID 175044948) has the molecular formula C24H14ClFN2O6 and a molecular weight of 480.84 g/mol. Its IUPAC name is 5-[[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 5-[[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 175044948 |
| Molecular Formula | C24H14ClFN2O6 |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 5-[[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]amino]pyridine-2-carboxylic acid |
| SMILES | O=CC(C(=O)Nc1ccc(C(=O)O)nc1)c1ccc2c(-c3ccc(F)cc3Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H14ClFN2O6/c25-19-8-13(26)2-5-15(19)17-9-22(30)34-21-7-12(1-4-16(17)21)18(11-29)23(31)28-14-3-6-20(24(32)33)27-10-14/h1-11,18H,(H,28,31)(H,32,33) |
| InChIKey | HCNLIGOIZZJPPL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|