C22H23ClFNO4 — CID 167498946
ethane;ethyl 2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]amino]propanoate (PubChem CID 167498946) has the molecular formula C22H23ClFNO4 and a molecular weight of 419.88 g/mol. Its IUPAC name is ethane;ethyl 2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]amino]propanoate.
| Compound Name | ethane;ethyl 2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]amino]propanoate |
|---|---|
| PubChem CID | 167498946 |
| Molecular Formula | C22H23ClFNO4 |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | ethane;ethyl 2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]amino]propanoate |
| SMILES | CC.CCOC(=O)C(C)Nc1ccc2c(-c3ccc(F)cc3Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H17ClFNO4.C2H6/c1-3-26-20(25)11(2)23-13-5-7-15-16(10-19(24)27-18(15)9-13)14-6-4-12(22)8-17(14)21;1-2/h4-11,23H,3H2,1-2H3;1-2H3 |
| InChIKey | DTGSFMPCZNOVPY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|