C21H19ClFNO4 — CID 167499008
ethyl (2S)-2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-(deuteriomethyl)amino]propanoate (PubChem CID 167499008) has the molecular formula C21H19ClFNO4 and a molecular weight of 404.84 g/mol. Its IUPAC name is ethyl (2S)-2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-(deuteriomethyl)amino]propanoate.
| Compound Name | ethyl (2S)-2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-(deuteriomethyl)amino]propanoate |
|---|---|
| PubChem CID | 167499008 |
| Molecular Formula | C21H19ClFNO4 |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | ethyl (2S)-2-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-(deuteriomethyl)amino]propanoate |
| SMILES | [2H]CN(c1ccc2c(-c3ccc(F)cc3Cl)cc(=O)oc2c1)[C@@H](C)C(=O)OCC |
| InChI | InChI=1S/C21H19ClFNO4/c1-4-27-21(26)12(2)24(3)14-6-8-16-17(11-20(25)28-19(16)10-14)15-7-5-13(23)9-18(15)22/h5-12H,4H2,1-3H3/t12-/m0/s1/i3D |
| InChIKey | UQMDLSOTQQLELT-NIRIOKBMSA-N |
| XLogP | 4.64 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|