C24H24ClFN2O5 — CID 167499120
N-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]methyl]-N-methylpiperidine-1-carboxamide;formic acid (PubChem CID 167499120) has the molecular formula C24H24ClFN2O5 and a molecular weight of 474.92 g/mol. Its IUPAC name is N-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]methyl]-N-methylpiperidine-1-carboxamide;formic acid.
| Compound Name | N-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]methyl]-N-methylpiperidine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 167499120 |
| Molecular Formula | C24H24ClFN2O5 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]methyl]-N-methylpiperidine-1-carboxamide;formic acid |
| SMILES | CN(Cc1ccc2c(-c3ccc(F)cc3Cl)cc(=O)oc2c1)C(=O)N1CCCCC1.O=CO |
| InChI | InChI=1S/C23H22ClFN2O3.CH2O2/c1-26(23(29)27-9-3-2-4-10-27)14-15-5-7-18-19(13-22(28)30-21(18)11-15)17-8-6-16(25)12-20(17)24;2-1-3/h5-8,11-13H,2-4,9-10,14H2,1H3;1H,(H,2,3) |
| InChIKey | SPQXJSHTCXENMO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|