C24H20ClFN2O6 — CID 175042590
methyl (2R)-4-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperazine-2-carboxylate (PubChem CID 175042590) has the molecular formula C24H20ClFN2O6 and a molecular weight of 486.88 g/mol. Its IUPAC name is methyl (2R)-4-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperazine-2-carboxylate.
| Compound Name | methyl (2R)-4-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 175042590 |
| Molecular Formula | C24H20ClFN2O6 |
| Molecular Weight | 486.88 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | methyl (2R)-4-[2-[4-(2-chloro-4-fluorophenyl)-2-oxochromen-7-yl]-3-oxopropanoyl]piperazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=O)C(C=O)c2ccc3c(-c4ccc(F)cc4Cl)cc(=O)oc3c2)CCN1 |
| InChI | InChI=1S/C24H20ClFN2O6/c1-33-24(32)20-11-28(7-6-27-20)23(31)18(12-29)13-2-4-16-17(10-22(30)34-21(16)8-13)15-5-3-14(26)9-19(15)25/h2-5,8-10,12,18,20,27H,6-7,11H2,1H3/t18?,20-/m1/s1 |
| InChIKey | MZNQKEOAVYMJGB-ROPPNANJSA-N |
| XLogP | 2.51 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.88 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|