C26H28ClNO4 — CID 155119674
(2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxy-N-(1-cyclopentylpropan-2-yl)propanamide (PubChem CID 155119674) has the molecular formula C26H28ClNO4 and a molecular weight of 453.97 g/mol. Its IUPAC name is (2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxy-N-(1-cyclopentylpropan-2-yl)propanamide.
| Compound Name | (2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxy-N-(1-cyclopentylpropan-2-yl)propanamide |
|---|---|
| PubChem CID | 155119674 |
| Molecular Formula | C26H28ClNO4 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (2R)-2-[4-(2-chlorophenyl)-2-oxochromen-7-yl]oxy-N-(1-cyclopentylpropan-2-yl)propanamide |
| SMILES | CC(CC1CCCC1)NC(=O)[C@@H](C)Oc1ccc2c(-c3ccccc3Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H28ClNO4/c1-16(13-18-7-3-4-8-18)28-26(30)17(2)31-19-11-12-21-22(15-25(29)32-24(21)14-19)20-9-5-6-10-23(20)27/h5-6,9-12,14-18H,3-4,7-8,13H2,1-2H3,(H,28,30)/t16?,17-/m1/s1 |
| InChIKey | FZFFMRQYPBKCMD-ZYMOGRSISA-N |
| XLogP | 5.97 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|