C24H30ClNO5 — CID 6570640
7-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-6-chlorochromen-2-one (PubChem CID 6570640) has the molecular formula C24H30ClNO5 and a molecular weight of 447.96 g/mol. Its IUPAC name is 7-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-6-chlorochromen-2-one.
| Compound Name | 7-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-6-chlorochromen-2-one |
|---|---|
| PubChem CID | 6570640 |
| Molecular Formula | C24H30ClNO5 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 7-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-6-chlorochromen-2-one |
| SMILES | CCCCc1cc(=O)oc2cc(OCC(=O)N3CC[C@@]4(O)CCCC[C@@H]4C3)c(Cl)cc12 |
| InChI | InChI=1S/C24H30ClNO5/c1-2-3-6-16-11-23(28)31-20-13-21(19(25)12-18(16)20)30-15-22(27)26-10-9-24(29)8-5-4-7-17(24)14-26/h11-13,17,29H,2-10,14-15H2,1H3/t17-,24+/m1/s1 |
| InChIKey | PFSKGLGIQLSKPU-OSPHWJPCSA-N |
| XLogP | 4.32 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|