C22H26ClNO5 — CID 11875640
7-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-6-chloro-4-ethylchromen-2-one (PubChem CID 11875640) has the molecular formula C22H26ClNO5 and a molecular weight of 419.91 g/mol. Its IUPAC name is 7-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-6-chloro-4-ethylchromen-2-one.
| Compound Name | 7-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-6-chloro-4-ethylchromen-2-one |
|---|---|
| PubChem CID | 11875640 |
| Molecular Formula | C22H26ClNO5 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 7-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-6-chloro-4-ethylchromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)N3CC[C@@]4(O)CCCC[C@H]4C3)c(Cl)cc12 |
| InChI | InChI=1S/C22H26ClNO5/c1-2-14-9-21(26)29-18-11-19(17(23)10-16(14)18)28-13-20(25)24-8-7-22(27)6-4-3-5-15(22)12-24/h9-11,15,27H,2-8,12-13H2,1H3/t15-,22-/m0/s1 |
| InChIKey | FSUVYUNLVBJENN-NYHFZMIOSA-N |
| XLogP | 3.54 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|