C29H41NO5 — CID 51553158
7-[2-[(1S,4aR,8aS)-1-butyl-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-8-methylchromen-2-one (PubChem CID 51553158) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is 7-[2-[(1S,4aR,8aS)-1-butyl-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-8-methylchromen-2-one.
| Compound Name | 7-[2-[(1S,4aR,8aS)-1-butyl-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-8-methylchromen-2-one |
|---|---|
| PubChem CID | 51553158 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 7-[2-[(1S,4aR,8aS)-1-butyl-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-4-butyl-8-methylchromen-2-one |
| SMILES | CCCCc1cc(=O)oc2c(C)c(OCC(=O)N3CC[C@]4(O)CCCC[C@H]4[C@@H]3CCCC)ccc12 |
| InChI | InChI=1S/C29H41NO5/c1-4-6-10-21-18-27(32)35-28-20(3)25(14-13-22(21)28)34-19-26(31)30-17-16-29(33)15-9-8-11-23(29)24(30)12-7-5-2/h13-14,18,23-24,33H,4-12,15-17,19H2,1-3H3/t23-,24-,29+/m0/s1 |
| InChIKey | HQHYUDWSTNBWEV-NDIVSWGXSA-N |
| XLogP | 5.54 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|