C27H36N2O6 — CID 125278026
(2R)-N-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxypropanamide (PubChem CID 125278026) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is (2R)-N-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxypropanamide.
| Compound Name | (2R)-N-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 125278026 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (2R)-N-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-2-(8-methyl-2-oxo-4-propylchromen-7-yl)oxypropanamide |
| SMILES | CCCc1cc(=O)oc2c(C)c(O[C@H](C)C(=O)NCC(=O)N3CC[C@]4(O)CCCC[C@H]4C3)ccc12 |
| InChI | InChI=1S/C27H36N2O6/c1-4-7-19-14-24(31)35-25-17(2)22(10-9-21(19)25)34-18(3)26(32)28-15-23(30)29-13-12-27(33)11-6-5-8-20(27)16-29/h9-10,14,18,20,33H,4-8,11-13,15-16H2,1-3H3,(H,28,32)/t18-,20+,27-/m1/s1 |
| InChIKey | LCQCXBNKKAGCCX-ZNFWPTJWSA-N |
| XLogP | 3.09 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|