C35H36ClNO5 — CID 124870508
7-[2-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-3-benzyl-4,8-dimethylchromen-2-one (PubChem CID 124870508) has the molecular formula C35H36ClNO5 and a molecular weight of 586.13 g/mol. Its IUPAC name is 7-[2-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-3-benzyl-4,8-dimethylchromen-2-one.
| Compound Name | 7-[2-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-3-benzyl-4,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 124870508 |
| Molecular Formula | C35H36ClNO5 |
| Molecular Weight | 586.13 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 7-[2-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethoxy]-3-benzyl-4,8-dimethylchromen-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c(C)c(OCC(=O)N3CC[C@]4(O)CCCC[C@H]4[C@H]3c3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C35H36ClNO5/c1-22-27-15-16-30(23(2)33(27)42-34(39)28(22)20-24-8-4-3-5-9-24)41-21-31(38)37-19-18-35(40)17-7-6-10-29(35)32(37)25-11-13-26(36)14-12-25/h3-5,8-9,11-16,29,32,40H,6-7,10,17-21H2,1-2H3/t29-,32+,35+/m0/s1 |
| InChIKey | MESXQYPVOTYEMT-MYWKAQKNSA-N |
| XLogP | 6.93 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.13 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|