C25H27NO5 — CID 4972948
2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 4972948) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4972948 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxy-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c(C)c(OCC(=O)NCC3CCCO3)ccc12 |
| InChI | InChI=1S/C25H27NO5/c1-16-20-10-11-22(30-15-23(27)26-14-19-9-6-12-29-19)17(2)24(20)31-25(28)21(16)13-18-7-4-3-5-8-18/h3-5,7-8,10-11,19H,6,9,12-15H2,1-2H3,(H,26,27) |
| InChIKey | AQIZQRSVCRSMME-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|