C23H21N3O5 — CID 155814790
3-amino-2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1H-pyrazol-5-one (PubChem CID 155814790) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-amino-2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1H-pyrazol-5-one.
| Compound Name | 3-amino-2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 155814790 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-amino-2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1H-pyrazol-5-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c(C)c(OCC(=O)n3[nH]c(=O)cc3N)ccc12 |
| InChI | InChI=1S/C23H21N3O5/c1-13-16-8-9-18(30-12-21(28)26-19(24)11-20(27)25-26)14(2)22(16)31-23(29)17(13)10-15-6-4-3-5-7-15/h3-9,11H,10,12,24H2,1-2H3,(H,25,27) |
| InChIKey | OUWKAZDRMFDMDI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|