C36H38ClNO5 — CID 124894203
5-[(2R)-1-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3-benzyl-4,7-dimethylchromen-2-one (PubChem CID 124894203) has the molecular formula C36H38ClNO5 and a molecular weight of 600.16 g/mol. Its IUPAC name is 5-[(2R)-1-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3-benzyl-4,7-dimethylchromen-2-one.
| Compound Name | 5-[(2R)-1-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3-benzyl-4,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 124894203 |
| Molecular Formula | C36H38ClNO5 |
| Molecular Weight | 600.16 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 5-[(2R)-1-[(1S,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3-benzyl-4,7-dimethylchromen-2-one |
| SMILES | Cc1cc(O[C@H](C)C(=O)N2CC[C@]3(O)CCCC[C@H]3[C@H]2c2ccc(Cl)cc2)c2c(C)c(Cc3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C36H38ClNO5/c1-22-19-30(32-23(2)28(35(40)43-31(32)20-22)21-25-9-5-4-6-10-25)42-24(3)34(39)38-18-17-36(41)16-8-7-11-29(36)33(38)26-12-14-27(37)15-13-26/h4-6,9-10,12-15,19-20,24,29,33,41H,7-8,11,16-18,21H2,1-3H3/t24-,29+,33-,36-/m1/s1 |
| InChIKey | FATPWFRRUDRUAS-UHGIWGQXSA-N |
| XLogP | 7.32 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.16 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|