C31H35NO5 — CID 40824671
9-[(2R)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-7-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 40824671) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is 9-[(2R)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-7-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | 9-[(2R)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-7-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 40824671 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 9-[(2R)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-7-methyl-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | Cc1cc(O[C@H](C)C(=O)N2CC[C@@]3(O)CCCC[C@@H]3[C@@H]2c2ccccc2)c2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C31H35NO5/c1-19-17-25(27-22-11-8-12-23(22)30(34)37-26(27)18-19)36-20(2)29(33)32-16-15-31(35)14-7-6-13-24(31)28(32)21-9-4-3-5-10-21/h3-5,9-10,17-18,20,24,28,35H,6-8,11-16H2,1-2H3/t20-,24-,28+,31+/m1/s1 |
| InChIKey | BWQNNIAILQPYSH-WYFALGAESA-N |
| XLogP | 5.25 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|