C24H31NO5 — CID 7001935
5-[(2R)-1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,7-trimethylchromen-2-one (PubChem CID 7001935) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 5-[(2R)-1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,7-trimethylchromen-2-one.
| Compound Name | 5-[(2R)-1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,7-trimethylchromen-2-one |
|---|---|
| PubChem CID | 7001935 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 5-[(2R)-1-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,7-trimethylchromen-2-one |
| SMILES | Cc1cc(O[C@H](C)C(=O)N2CC[C@]3(O)CCCC[C@H]3C2)c2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C24H31NO5/c1-14-11-19(21-15(2)16(3)23(27)30-20(21)12-14)29-17(4)22(26)25-10-9-24(28)8-6-5-7-18(24)13-25/h11-12,17-18,28H,5-10,13H2,1-4H3/t17-,18+,24-/m1/s1 |
| InChIKey | XMFJEQPGFKCYHW-NXMSCROESA-N |
| XLogP | 3.64 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|