C19H21F2NO4 — CID 171913046
5-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one (PubChem CID 171913046) has the molecular formula C19H21F2NO4 and a molecular weight of 365.38 g/mol. Its IUPAC name is 5-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one.
| Compound Name | 5-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one |
|---|---|
| PubChem CID | 171913046 |
| Molecular Formula | C19H21F2NO4 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OC(C)C(=O)N3CCC(F)(F)C3)c12 |
| InChI | InChI=1S/C19H21F2NO4/c1-4-13-9-16(23)26-15-8-11(2)7-14(17(13)15)25-12(3)18(24)22-6-5-19(20,21)10-22/h7-9,12H,4-6,10H2,1-3H3 |
| InChIKey | KEFUHVQWZZPMQV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|