C24H32N2O5 — CID 172655896
2-[1-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxypropanoyl]piperidin-4-yl]-N,N-dimethylacetamide (PubChem CID 172655896) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[1-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxypropanoyl]piperidin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[1-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxypropanoyl]piperidin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 172655896 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-[1-[2-(4-ethyl-7-methyl-2-oxochromen-5-yl)oxypropanoyl]piperidin-4-yl]-N,N-dimethylacetamide |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OC(C)C(=O)N3CCC(CC(=O)N(C)C)CC3)c12 |
| InChI | InChI=1S/C24H32N2O5/c1-6-18-14-22(28)31-20-12-15(2)11-19(23(18)20)30-16(3)24(29)26-9-7-17(8-10-26)13-21(27)25(4)5/h11-12,14,16-17H,6-10,13H2,1-5H3 |
| InChIKey | MBNAGFZDPLKSIU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|