C24H27N3O4 — CID 171908164
4-ethyl-7-methyl-5-[1-oxo-1-(4-pyridin-3-ylpiperazin-1-yl)propan-2-yl]oxychromen-2-one (PubChem CID 171908164) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-ethyl-7-methyl-5-[1-oxo-1-(4-pyridin-3-ylpiperazin-1-yl)propan-2-yl]oxychromen-2-one.
| Compound Name | 4-ethyl-7-methyl-5-[1-oxo-1-(4-pyridin-3-ylpiperazin-1-yl)propan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 171908164 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-ethyl-7-methyl-5-[1-oxo-1-(4-pyridin-3-ylpiperazin-1-yl)propan-2-yl]oxychromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(C)cc(OC(C)C(=O)N3CCN(c4cccnc4)CC3)c12 |
| InChI | InChI=1S/C24H27N3O4/c1-4-18-14-22(28)31-21-13-16(2)12-20(23(18)21)30-17(3)24(29)27-10-8-26(9-11-27)19-6-5-7-25-15-19/h5-7,12-15,17H,4,8-11H2,1-3H3 |
| InChIKey | HLRDWVSWFITJJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|