C24H32N2O6 — CID 172896491
acetic acid;5-[1-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one (PubChem CID 172896491) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is acetic acid;5-[1-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one.
| Compound Name | acetic acid;5-[1-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one |
|---|---|
| PubChem CID | 172896491 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | acetic acid;5-[1-[(1R,5S)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-4-ethyl-7-methylchromen-2-one |
| SMILES | CC(=O)O.CCc1cc(=O)oc2cc(C)cc(OC(C)C(=O)N3C[C@H]4CC[C@@H](C3)C4N)c12 |
| InChI | InChI=1S/C22H28N2O4.C2H4O2/c1-4-14-9-19(25)28-18-8-12(2)7-17(20(14)18)27-13(3)22(26)24-10-15-5-6-16(11-24)21(15)23;1-2(3)4/h7-9,13,15-16,21H,4-6,10-11,23H2,1-3H3;1H3,(H,3,4)/t13?,15-,16+,21?; |
| InChIKey | HXPONVCWFPXLOR-WCTYIWIFSA-N |
| XLogP | 2.72 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|