C16H18O4 — CID 701525
4-ethyl-7-methyl-5-[(2S)-3-oxobutan-2-yl]oxychromen-2-one (PubChem CID 701525) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-ethyl-7-methyl-5-[(2S)-3-oxobutan-2-yl]oxychromen-2-one.
| Compound Name | 4-ethyl-7-methyl-5-[(2S)-3-oxobutan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 701525 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-ethyl-7-methyl-5-[(2S)-3-oxobutan-2-yl]oxychromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(C)cc(O[C@@H](C)C(C)=O)c12 |
| InChI | InChI=1S/C16H18O4/c1-5-12-8-15(18)20-14-7-9(2)6-13(16(12)14)19-11(4)10(3)17/h6-8,11H,5H2,1-4H3/t11-/m0/s1 |
| InChIKey | WBHWJTKSRIWMKN-NSHDSACASA-N |
| XLogP | 3.02 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|