C32H36ClNO5 — CID 124865398
3-[(2S)-1-[(1R,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxobutan-2-yl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 124865398) has the molecular formula C32H36ClNO5 and a molecular weight of 550.10 g/mol. Its IUPAC name is 3-[(2S)-1-[(1R,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxobutan-2-yl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[(2S)-1-[(1R,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxobutan-2-yl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 124865398 |
| Molecular Formula | C32H36ClNO5 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 3-[(2S)-1-[(1R,4aR,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxobutan-2-yl]oxy-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CC[C@H](Oc1ccc2c3c(c(=O)oc2c1)CCCC3)C(=O)N1CC[C@]2(O)CCCC[C@H]2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H36ClNO5/c1-2-27(38-22-14-15-24-23-7-3-4-8-25(23)31(36)39-28(24)19-22)30(35)34-18-17-32(37)16-6-5-9-26(32)29(34)20-10-12-21(33)13-11-20/h10-15,19,26-27,29,37H,2-9,16-18H2,1H3/t26-,27-,29-,32+/m0/s1 |
| InChIKey | MLQDZVFHGSAEKR-WIQGVFEGSA-N |
| XLogP | 6.38 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|