C31H36ClNO5 — CID 95371624
7-[(2S)-1-[(1R,4aS,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-4-butylchromen-2-one (PubChem CID 95371624) has the molecular formula C31H36ClNO5 and a molecular weight of 538.08 g/mol. Its IUPAC name is 7-[(2S)-1-[(1R,4aS,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-4-butylchromen-2-one.
| Compound Name | 7-[(2S)-1-[(1R,4aS,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-4-butylchromen-2-one |
|---|---|
| PubChem CID | 95371624 |
| Molecular Formula | C31H36ClNO5 |
| Molecular Weight | 538.08 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 7-[(2S)-1-[(1R,4aS,8aS)-1-(4-chlorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-4-butylchromen-2-one |
| SMILES | CCCCc1cc(=O)oc2cc(O[C@@H](C)C(=O)N3CC[C@@]4(O)CCCC[C@H]4[C@@H]3c3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C31H36ClNO5/c1-3-4-7-22-18-28(34)38-27-19-24(13-14-25(22)27)37-20(2)30(35)33-17-16-31(36)15-6-5-8-26(31)29(33)21-9-11-23(32)12-10-21/h9-14,18-20,26,29,36H,3-8,15-17H2,1-2H3/t20-,26-,29-,31-/m0/s1 |
| InChIKey | FQWBEZREHCUGGI-LOLDFXGMSA-N |
| XLogP | 6.45 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.08 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|