C30H35NO5 — CID 6570948
7-[(2S)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,8-trimethylchromen-2-one (PubChem CID 6570948) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is 7-[(2S)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,8-trimethylchromen-2-one.
| Compound Name | 7-[(2S)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,8-trimethylchromen-2-one |
|---|---|
| PubChem CID | 6570948 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 7-[(2S)-1-[(1R,4aS,8aR)-4a-hydroxy-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-oxopropan-2-yl]oxy-3,4,8-trimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(O[C@@H](C)C(=O)N3CC[C@@]4(O)CCCC[C@@H]4[C@@H]3c3ccccc3)c(C)c2oc1=O |
| InChI | InChI=1S/C30H35NO5/c1-18-19(2)29(33)36-27-20(3)25(14-13-23(18)27)35-21(4)28(32)31-17-16-30(34)15-9-8-12-24(30)26(31)22-10-6-5-7-11-22/h5-7,10-11,13-14,21,24,26,34H,8-9,12,15-17H2,1-4H3/t21-,24+,26-,30-/m0/s1 |
| InChIKey | ZPVWEGDUMYPORE-JWKSYKGJSA-N |
| XLogP | 5.38 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|