C29H32ClNO5 — CID 42235356
3-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(4-chlorophenyl)methoxy]-4,8-dimethylchromen-2-one (PubChem CID 42235356) has the molecular formula C29H32ClNO5 and a molecular weight of 510.03 g/mol. Its IUPAC name is 3-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(4-chlorophenyl)methoxy]-4,8-dimethylchromen-2-one.
| Compound Name | 3-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(4-chlorophenyl)methoxy]-4,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 42235356 |
| Molecular Formula | C29H32ClNO5 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 3-[2-[(4aR,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(4-chlorophenyl)methoxy]-4,8-dimethylchromen-2-one |
| SMILES | Cc1c(CC(=O)N2CC[C@]3(O)CCCC[C@H]3C2)c(=O)oc2c(C)c(OCc3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C29H32ClNO5/c1-18-23-10-11-25(35-17-20-6-8-22(30)9-7-20)19(2)27(23)36-28(33)24(18)15-26(32)31-14-13-29(34)12-4-3-5-21(29)16-31/h6-11,21,34H,3-5,12-17H2,1-2H3/t21-,29+/m0/s1 |
| InChIKey | GDGREZOYNAYYBP-KCWXNJEJSA-N |
| XLogP | 5.34 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|